ZL-Asp(tBu)-OH * DCHA structure
|
Common Name | ZL-Asp(tBu)-OH * DCHA | ||
|---|---|---|---|---|
| CAS Number | 23632-70-4 | Molecular Weight | 504.659 | |
| Density | N/A | Boiling Point | 666.9ºC at 760mmHg | |
| Molecular Formula | C28H44N2O6 | Melting Point | 107-109ºC | |
| MSDS | N/A | Flash Point | 357.1ºC | |
| Name | N-Benzyloxycarbonyl-L-aspartic Acid β-tert-Butyl Ester Dicyclohexylamine Salt |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 666.9ºC at 760mmHg |
|---|---|
| Melting Point | 107-109ºC |
| Molecular Formula | C28H44N2O6 |
| Molecular Weight | 504.659 |
| Flash Point | 357.1ºC |
| Exact Mass | 504.319946 |
| PSA | 113.96000 |
| LogP | 6.12100 |
| Vapour Pressure | 1.07E-18mmHg at 25°C |
| InChIKey | JEGXFHMMFLKBBW-YDALLXLXSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)CC(NC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | 2-8°C |
|
~95%
ZL-Asp(tBu)-OH ... CAS#:23632-70-4 |
| Literature: Namikoshi, Michio; Kundu, Bijoy; Rinehart, Kenneth L. Journal of Organic Chemistry, 1991 , vol. 56, # 18 p. 5464 - 5466 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-tert-butoxy-4-oxobutanoic acid - N-cyclohexylcyclohexanamine (1:1) (non-preferred name) |
| L-Aspartic acid, N-[(phenylmethoxy)carbonyl]-, 4-(1,1-dimethylethyl) ester, compd. with N-cyclohexylcyclohexanamine (1:1) |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid - N-cyclohexylcyclohexanamine (1:1) |
| Z-Asp-OtBu DCHA |
| N-cyclohexylcyclohexanamine,(2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| Z-Asp-OtBu.DCHA |
| Z-Asp-OtBu·DCHA |
| Z-Asp(OBut)-OH·DCHA |