5-endo-BCN-pentanoic acid structure
|
Common Name | 5-endo-BCN-pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2364591-80-8 | Molecular Weight | 293.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-endo-BCN-pentanoic acid5-endo-BCN-pentanoic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 5-endo-BCN-pentanoic acid |
|---|
| Description | 5-endo-BCN-pentanoic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C16H23NO4 |
|---|---|
| Molecular Weight | 293.36 |
| InChIKey | SHBBGNJSLQPJLH-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCNC(=O)OCC1C2CCC#CCCC21 |