2,3,5,6-Tetrafluoro-1,4-bis(trimethylstannyl)benzene structure
|
Common Name | 2,3,5,6-Tetrafluoro-1,4-bis(trimethylstannyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 23653-80-7 | Molecular Weight | 481.71500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24F4Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2,3,5,6-tetrafluoro-4-trimethylstannylphenyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H24F4Sn2 |
|---|---|
| Molecular Weight | 481.71500 |
| Exact Mass | 483.98600 |
| LogP | 5.66640 |
| InChIKey | RLOXGRVPXAGABQ-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)c1c(F)c(F)c([Sn](C)(C)C)c(F)c1F |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,3,5,6-Tetrafluoro-1,4-bis(trimethylstannyl)benzene |
| Stannane,(2,3,5,6-tetrafluoro-p-phenylene)bis*trimethyl |