benzyl(triethyl)phosphanium,chloride
benzyl(triethyl)phosphanium,chloride structure
|
Common Name | benzyl(triethyl)phosphanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 23666-92-4 | Molecular Weight | 244.74100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22ClP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl(triethyl)phosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22ClP |
|---|---|
| Molecular Weight | 244.74100 |
| Exact Mass | 244.11500 |
| PSA | 13.59000 |
| LogP | 1.26790 |
| InChIKey | OZXRLJIEKITDLN-UHFFFAOYSA-M |
| SMILES | CC[P+](CC)(CC)Cc1ccccc1.[Cl-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
benzyl(triethyl... CAS#:23666-92-4 |
| Literature: Hofmann,A. W. Justus Liebigs Annalen der Chemie, 1861 , vol. Suppl.1, p. 323 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 3 | |
CAS#:100-44-7
CAS#:41268-70-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phosphonium,triethyl(phenylmethyl)-,chloride |
| Triaethyl-benzyl-phosphonium,Chlorid |
| triethylbenzyl phosphonium chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does benzyl(triethyl)phosphanium,chloride have? |
| A: English synonyms of benzyl(triethyl)phosphanium,chloride: Phosphonium,triethyl(phenylmethyl)-,chloride, Triaethyl-benzyl-phosphonium,Chlorid, triethylbenzyl phosphonium chloride. |
| Q: What is the Chinese name of 23666-92-4? |
| A: Chinese name of 23666-92-4 is 23666-92-4. |
| Q: What is the molecular formula of benzyl(triethyl)phosphanium,chloride? |
| A: Molecular formula of benzyl(triethyl)phosphanium,chloride is C13H22ClP. |
| Q: What is the CAS number of benzyl(triethyl)phosphanium,chloride? |
| A: CAS number of benzyl(triethyl)phosphanium,chloride is 23666-92-4. |
| Q: What is the molecular weight of benzyl(triethyl)phosphanium,chloride? |
| A: Molecular weight of benzyl(triethyl)phosphanium,chloride is 244.74100. |
| Q: What is the LogP of benzyl(triethyl)phosphanium,chloride? |
| A: LogP of benzyl(triethyl)phosphanium,chloride is 1.26790. |
| Q: What is the polar surface area (PSA) of benzyl(triethyl)phosphanium,chloride? |
| A: Polar surface area (PSA) of benzyl(triethyl)phosphanium,chloride is 13.59000. |
| Q: What is the English name of benzyl(triethyl)phosphanium,chloride? |
| A: The English name of benzyl(triethyl)phosphanium,chloride is benzyl(triethyl)phosphanium,chloride. |
| Q: What are the upstream materials of benzyl(triethyl)phosphanium,chloride? |
| A: Related upstream materials(CAS) of benzyl(triethyl)phosphanium,chloride: 98-87-3;64-17-5;554-70-1. |
| Q: What are the downstream products of benzyl(triethyl)phosphanium,chloride? |
| A: Related downstream products(CAS) of benzyl(triethyl)phosphanium,chloride: 100-44-7;554-70-1;41268-70-6. |