1-Cyclohexene-1-carboxylicacid, 3-oxo-6-phenyl structure
|
Common Name | 1-Cyclohexene-1-carboxylicacid, 3-oxo-6-phenyl | ||
|---|---|---|---|---|
| CAS Number | 23673-46-3 | Molecular Weight | 216.23300 | |
| Density | 1.266g/cm3 | Boiling Point | 340.7ºC at 760mmHg | |
| Molecular Formula | C13H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | 3-oxo-6-phenylcyclohexene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 340.7ºC at 760mmHg |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.23300 |
| Flash Point | 174ºC |
| Exact Mass | 216.07900 |
| PSA | 54.37000 |
| LogP | 2.14410 |
| Vapour Pressure | 3.27E-05mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | CNSIIZPEWAVOMI-UHFFFAOYSA-N |
| SMILES | O=C1C=C(C(=O)O)C(c2ccccc2)CC1 |
|
~%
1-Cyclohexene-1... CAS#:23673-46-3 |
| Literature: Ziegler,F.E.; Condon,M.E. Journal of Organic Chemistry, 1971 , vol. 36, p. 3707 - 3714 |
|
~%
1-Cyclohexene-1... CAS#:23673-46-3 |
| Literature: Ziegler,F.E.; Condon,M.E. Journal of Organic Chemistry, 1971 , vol. 36, p. 3707 - 3714 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Cyclohexene-1-carboxylicacid,3-oxo-6-phenyl |
| 3-oxo-6-phenylcyclohex-1-ene-1-carboxylic acid |
| 3-Oxo-6-phenyl-1-cyclohexencarbonsaeure |