5,6,7-Trimethoxy-2-naphthalenecarboxylic acid methyl ester structure
|
Common Name | 5,6,7-Trimethoxy-2-naphthalenecarboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 23673-53-2 | Molecular Weight | 276.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5,6,7-trimethoxynaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O5 |
|---|---|
| Molecular Weight | 276.28500 |
| Exact Mass | 276.10000 |
| PSA | 53.99000 |
| LogP | 2.65220 |
| InChIKey | POZJFDUKFIWVOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(OC)c(OC)c(OC)cc2c1 |
| HS Code | 2918990090 |
|---|
|
~%
5,6,7-Trimethox... CAS#:23673-53-2 |
| Literature: Chen,C.-L.; Hostettler,F.D. Tetrahedron, 1969 , vol. 25, p. 3223 - 3229 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5,6,7-Trimethoxy-2-naphthoesaeure-methylester |
| 2-Naphthalenecarboxylic acid,5,6,7-trimethoxy-,methyl ester |
| 2-Naphthoic acid,5,6,7-trimethoxy-,methyl ester |
| 5,6,7-Trimethoxy-2-naphthalenecarboxylic acid methyl ester |