4-fluoro-N-(2-oxo-2-phenylethyl)benzamide structure
|
Common Name | 4-fluoro-N-(2-oxo-2-phenylethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 2368-16-3 | Molecular Weight | 257.26000 | |
| Density | 1.225g/cm3 | Boiling Point | 454.3ºC at 760 mmHg | |
| Molecular Formula | C15H12FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.5ºC | |
| Name | 4-fluoro-N-phenacylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 454.3ºC at 760 mmHg |
| Molecular Formula | C15H12FNO2 |
| Molecular Weight | 257.26000 |
| Flash Point | 228.5ºC |
| Exact Mass | 257.08500 |
| PSA | 46.17000 |
| LogP | 2.82930 |
| Vapour Pressure | 1.93E-08mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | FPIJNHLMAJVZIV-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Fluoro-N-[1-(2-oxo-2-phenylethyl)]benzamide |
| 4-Fluor-benzoesaeure-phenacylamid |
| 4-fluoro-N-(2-oxo-2-phenylethyl)benzamide |
| 4-fluoro-benzoic acid phenacylamide |
| (4-Fluor-benzoylaminomethyl)-phenyl-keton |