1-[2-[(4-Methylphenyl)amino]phenyl]ethanon
![1-[2-[(4-Methylphenyl)amino]phenyl]ethanon Structure](https://image.chemsrc.com/caspic/021/23699-75-4.png)
1-[2-[(4-Methylphenyl)amino]phenyl]ethanon structure
|
Common Name | 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon | ||
|---|---|---|---|---|
| CAS Number | 23699-75-4 | Molecular Weight | 225.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15NO |
|---|---|
| Molecular Weight | 225.28600 |
| Exact Mass | 225.11500 |
| PSA | 29.10000 |
| LogP | 4.01420 |
| InChIKey | VUUFCZQSVDLVAA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccccc1Nc1ccc(C)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:23864-43-9
CAS#:918163-01-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(2-(p-tolylamino)phenyl)ethanone |
| (Acetyl-2-phenyl)-(methyl-4'-phenyl)-amin |
| 1-[2-(4-methylphenylamino)phenyl]ethanone |
| 1-(2-((4-methylphenyl)amino)phenyl)ethanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon have? |
| A: English synonyms of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon: 1-(2-(p-tolylamino)phenyl)ethanone, (Acetyl-2-phenyl)-(methyl-4'-phenyl)-amin, 1-[2-(4-methylphenylamino)phenyl]ethanone, 1-(2-((4-methylphenyl)amino)phenyl)ethanone. |
| Q: What is the SMILES notation of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon? |
| A: SMILES notation of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon is CC(=O)c1ccccc1Nc1ccc(C)cc1. |
| Q: What is the Chinese name of 23699-75-4? |
| A: Chinese name of 23699-75-4 is 23699-75-4. |
| Q: What is the molecular formula of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon? |
| A: Molecular formula of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon is C15H15NO. |
| Q: What is the English name of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon? |
| A: The English name of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon is 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon. |
| Q: What is the InChIKey of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon? |
| A: InChIKey of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon is VUUFCZQSVDLVAA-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon? |
| A: LogP of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon is 4.01420. |
| Q: What are the downstream products of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon? |
| A: Related downstream products(CAS) of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon: 23864-43-9;918163-01-6. |
| Q: What is the CAS number of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon? |
| A: CAS number of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon is 23699-75-4. |
| Q: What is the molecular weight of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon? |
| A: Molecular weight of 1-[2-[(4-Methylphenyl)amino]phenyl]ethanon is 225.28600. |