2,3-O-Isopropylidene-2-C-methyl-D-ribonic-gamma-lactone structure
|
Common Name | 2,3-O-Isopropylidene-2-C-methyl-D-ribonic-gamma-lactone | ||
|---|---|---|---|---|
| CAS Number | 23709-41-3 | Molecular Weight | 162.14100 | |
| Density | 1.23 | Boiling Point | 328ºC | |
| Molecular Formula | C6H10O5 | Melting Point | 52-54ºC | |
| MSDS | N/A | Flash Point | 130ºC | |
| Name | (3aR,6aR)-6-(hydroxymethyl)-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23 |
|---|---|
| Boiling Point | 328ºC |
| Melting Point | 52-54ºC |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14100 |
| Flash Point | 130ºC |
| Exact Mass | 162.05300 |
| PSA | 86.99000 |
| InChIKey | JTORQZQZELCRKV-HCVRKRLWSA-N |
| SMILES | CC1(C)OC2C(CO)OC(=O)C2(C)O1 |
|
~99%
2,3-O-Isopropyl... CAS#:23709-41-3 |
| Literature: Dukhan; Bosc; Peyronnet; Storer; Gosselin Nucleosides, Nucleotides and Nucleic Acids, 2005 , vol. 24, # 5-7 p. 577 - 580 |
|
~%
2,3-O-Isopropyl... CAS#:23709-41-3 |
| Literature: WO2011/35250 A1, ; Page/Page column 79-80 ; |
|
~99%
2,3-O-Isopropyl... CAS#:23709-41-3 |
| Literature: Pontiggia, Rodrigo; Pontiggia, Osvaldo; Simian, Marina; Montserrat, Javier M.; Engels, Joachim W.; Iribarren, Adolfo M. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 9 p. 2806 - 2808 |
|
~%
2,3-O-Isopropyl... CAS#:23709-41-3 |
| Literature: Doklady Akademii Nauk SSSR, , vol. 93, p. 301 Chem.Abstr., , p. 12676 |
| 2-C-Methyl-2,3-O-isopropylidene-D-ribono-1,4-lactone |
| 2,3-O-isopropylidene-2-C-methyl-D-ribono-1,4-lactone |
| O2,O3-isopropylidene-2-methyl-D-ribonic acid-4-lactone |
| TG-212-29-A |
| O2,O3-Isopropyliden-2-methyl-D-ribonsaeure-4-lacton |
| 2,3-O-Isopropylidene-2-C-methyl-D-ribonic Acid |A-Lactone |