Inixaciclib structure
|
Common Name | Inixaciclib | ||
|---|---|---|---|---|
| CAS Number | 2370913-42-9 | Molecular Weight | 480.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H30F2N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of InixaciclibInixaciclib is a potent CDK inhibitor, that can be used to research anticancer. |
| Name | Inixaciclib |
|---|
| Description | Inixaciclib is a potent CDK inhibitor, that can be used to research anticancer. |
|---|---|
| Related Catalog | |
| Target |
CDK[1] |
| Molecular Formula | C26H30F2N6O |
|---|---|
| Molecular Weight | 480.55 |
| InChIKey | YZSCPLGKKMSBMV-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCOc2c(F)cc(-c3nc(Nc4ccc(C5CCN(C)CC5)cn4)ncc3F)cc21 |