cyclohexyl 5-fluoropyridine-3-carboxylate structure
|
Common Name | cyclohexyl 5-fluoropyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 23723-26-4 | Molecular Weight | 223.24300 | |
| Density | 1.18g/cm3 | Boiling Point | 303ºC at 760mmHg | |
| Molecular Formula | C12H14FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.1ºC | |
| Name | cyclohexyl 5-fluoropyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 303ºC at 760mmHg |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.24300 |
| Flash Point | 137.1ºC |
| Exact Mass | 223.10100 |
| PSA | 39.19000 |
| LogP | 2.71020 |
| Vapour Pressure | 0.000955mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | KCYOUPHUBLMKGO-UHFFFAOYSA-N |
| SMILES | O=C(OC1CCCCC1)c1cncc(F)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Cyclohexyl-5-fluornicotinat |
| 5-Fluor-nicotinsaeure-cyclohexylester |
| 3-Pyridinecarboxylic acid,5-fluoro-,cyclohexyl ester |
| Cyclohexyl 5-fluoronicotinate |
| Cyclohexyl 5-fluoro-3-pyridinecarboxylate |
| nicotinic acid,5-fluoro-,cyclohexyl ester(8ci) |