(Z)-alpha-damascone
Modify Date: 2025-08-25 12:49:02
(Z)-alpha-damascone structure
|
Common Name | (Z)-alpha-damascone | ||
|---|---|---|---|---|
| CAS Number | 23726-94-5 | Molecular Weight | 192.29700 | |
| Density | 0.898g/cm3 | Boiling Point | 267.1ºC at 760 mmHg | |
| Molecular Formula | C13H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.7ºC | |
| Name | (Z)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.898g/cm3 |
|---|---|
| Boiling Point | 267.1ºC at 760 mmHg |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.29700 |
| Flash Point | 105.7ºC |
| Exact Mass | 192.15100 |
| PSA | 17.07000 |
| LogP | 3.51410 |
| Vapour Pressure | 0.0083mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | CRIGTVCBMUKRSL-ALCCZGGFSA-N |
| SMILES | CC=CC(=O)C1C(C)=CCCC1(C)C |
| HS Code | 2914299000 |
|---|
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
Total 6, Current Page 1 of 1
1
| 2-Buten-1-one,1-(2,6,6-trimethyl-2-cyclohexen-1-yl)-,(Z) |
| 4-(2,6,6-trimethyl-2-cyclohexenyl)-2-butene-4-one |
| 1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one |
| 1-(2,6,6-trimethyl-2-cyclohexen-1-yl)-but-2-en-1-one |
| (2)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-1-one |
| (Z)-1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one |