(25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid
Modify Date: 2026-08-31 11:16:11
(25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid structure
|
Common Name | (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid | ||
|---|---|---|---|---|
| CAS Number | 23740-15-0 | Molecular Weight | 434.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H46O4 |
|---|---|
| Molecular Weight | 434.7 |
| InChIKey | ITZYGDKGRKKBSN-IUXIIYGSSA-N |
| SMILES | CC(CCCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid? |
| A: Molecular weight of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid is 434.7. |
| Q: What is the Chinese name of 23740-15-0? |
| A: Chinese name of 23740-15-0 is 23740-15-0. |
| Q: What is the English name of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid? |
| A: The English name of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid is (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid. |
| Q: What is the SMILES notation of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid? |
| A: SMILES notation of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid is CC(CCCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C)C(=O)O. |
| Q: What is the CAS number of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid? |
| A: CAS number of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid is 23740-15-0. |
| Q: What is the molecular formula of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid? |
| A: Molecular formula of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid is C27H46O4. |
| Q: What is the InChIKey of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid? |
| A: InChIKey of (25S)-3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid is ITZYGDKGRKKBSN-IUXIIYGSSA-N. |