5-methyl-2-phenyl-1H-indol-3-amine structure
|
Common Name | 5-methyl-2-phenyl-1H-indol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 23747-09-3 | Molecular Weight | 222.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-2-phenyl-1H-indol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2 |
|---|---|
| Molecular Weight | 222.28500 |
| Exact Mass | 222.11600 |
| PSA | 41.81000 |
| LogP | 4.30670 |
| InChIKey | YDTXUTZFHNPJDF-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c(-c3ccccc3)c(N)c2c1 |
|
~%
5-methyl-2-phen... CAS#:23747-09-3 |
| Literature: Hiremath, Shivayogi P.; Badami, Prema S.; Purohit, Muralidhar G. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 1115 - 1119 |
|
~%
5-methyl-2-phen... CAS#:23747-09-3 |
| Literature: Hiremath, Shivayogi P.; Badami, Prema S.; Purohit, Muralidhar G. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 1115 - 1119 |
| 5-Methyl-2-phenyl-3-aminoindole |
| 1H-Indol-3-amine,5-methyl-2-phenyl |
| 5-methyl-3-amino-2-phenylindole |
| 5-methyl-2-phenyl-indol-3-ylamine |