FAPI-34 structure
|
Common Name | FAPI-34 | ||
|---|---|---|---|---|
| CAS Number | 2374782-07-5 | Molecular Weight | 1166.06 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C50H57F2N13O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FAPI-34FAPI-34 is a fibroblast-activating protein (FAP) inhibitor with favorable pharmacokinetic and biochemical properties. (patent WO2019154886A1). |
| Name | FAPI-34 |
|---|
| Description | FAPI-34 is a fibroblast-activating protein (FAP) inhibitor with favorable pharmacokinetic and biochemical properties. (patent WO2019154886A1). |
|---|---|
| Related Catalog | |
| Target |
Fibroblast activation protein (FAP) |
| References |
| Molecular Formula | C50H57F2N13O18 |
|---|---|
| Molecular Weight | 1166.06 |
| InChIKey | FPOZMWSPTRNDPQ-UVXHQIPUSA-N |
| SMILES | N#CC1CC(F)(F)CN1C(=O)CNC(=O)c1ccnc2ccc(OCCCN3CCN(C(=O)CN(Cc4nccn4CC(=O)NC(CC(C(=O)O)C(=O)O)C(=O)O)Cc4nccn4CC(=O)NC(CC(C(=O)O)C(=O)O)C(=O)O)CC3)cc12 |