Acetamide,2-(2,4,5-trichlorophenoxy)-N-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | Acetamide,2-(2,4,5-trichlorophenoxy)-N-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 2377-27-7 | Molecular Weight | 398.59200 | |
| Density | 1.531g/cm3 | Boiling Point | 510ºC at 760mmHg | |
| Molecular Formula | C15H9Cl3F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.2ºC | |
| Name | 2-(2,4,5-trichlorophenoxy)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.531g/cm3 |
|---|---|
| Boiling Point | 510ºC at 760mmHg |
| Molecular Formula | C15H9Cl3F3NO2 |
| Molecular Weight | 398.59200 |
| Flash Point | 262.2ºC |
| Exact Mass | 396.96500 |
| PSA | 38.33000 |
| LogP | 5.75610 |
| Vapour Pressure | 1.62E-10mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | FPBVXTPQOMYESI-UHFFFAOYSA-N |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)Nc1cccc(C(F)(F)F)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms551j17 |