4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride
Modify Date: 2026-08-12 09:31:40
![4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride Structure](https://www.chemsrc.com/extcaspic/152/2377032-72-7.png)
4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride structure
|
Common Name | 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2377032-72-7 | Molecular Weight | 219.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18ClNO2 |
|---|---|
| Molecular Weight | 219.71 |
| InChIKey | DLTDWWOZGWVJPO-UHFFFAOYSA-N |
| SMILES | CC1(C)OC2C3CCC(N)(C3)C2O1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2377032-72-7? |
| A: Chinese name of 2377032-72-7 is 2377032-72-7. |
| Q: What is the molecular weight of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride? |
| A: Molecular weight of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride is 219.71. |
| Q: What is the InChIKey of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride? |
| A: InChIKey of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride is DLTDWWOZGWVJPO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride? |
| A: CAS number of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride is 2377032-72-7. |
| Q: What is the molecular formula of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride? |
| A: Molecular formula of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride is C10H18ClNO2. |
| Q: What is the English name of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride? |
| A: The English name of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride is 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride. |
| Q: What is the SMILES notation of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride? |
| A: SMILES notation of 4,4-Dimethyl-3,5-dioxatricyclo[5.2.1.0,2,6]decan-1-amine hydrochloride is CC1(C)OC2C3CCC(N)(C3)C2O1.Cl. |