5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester
Modify Date: 2026-07-04 18:42:47
5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester structure
|
Common Name | 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 2377608-23-4 | Molecular Weight | 332.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16BBrF2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16BBrF2O2 |
|---|---|
| Molecular Weight | 332.98 |
| InChIKey | YQAMGBQVBYXOJJ-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cc(Br)ccc2C(F)F)OC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester? |
| A: InChIKey of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester is YQAMGBQVBYXOJJ-UHFFFAOYSA-N. |
| Q: What is the English name of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester? |
| A: The English name of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester is 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester. |
| Q: What is the CAS number of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester? |
| A: CAS number of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester is 2377608-23-4. |
| Q: What is the molecular formula of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester? |
| A: Molecular formula of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester is C13H16BBrF2O2. |
| Q: What is the Chinese name of 2377608-23-4? |
| A: Chinese name of 2377608-23-4 is 2377608-23-4. |
| Q: What is the molecular weight of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester? |
| A: Molecular weight of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester is 332.98. |
| Q: What is the SMILES notation of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester? |
| A: SMILES notation of 5-Bromo-2-(difluoromethyl)phenylboronic acid pinacol ester is CC1(C)OB(c2cc(Br)ccc2C(F)F)OC1(C)C. |