4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester
Modify Date: 2025-08-28 09:48:18
4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester structure
|
Common Name | 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 2377611-94-2 | Molecular Weight | 307.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22BNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22BNO3S |
|---|---|
| Molecular Weight | 307.2 |
| InChIKey | ZMQRMBGLOORQIH-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cc(C(=O)N3CCCC3)cs2)OC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester? |
| A: InChIKey of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester is ZMQRMBGLOORQIH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester? |
| A: SMILES notation of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester is CC1(C)OB(c2cc(C(=O)N3CCCC3)cs2)OC1(C)C. |
| Q: What is the molecular weight of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester? |
| A: Molecular weight of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester is 307.2. |
| Q: What is the Chinese name of 2377611-94-2? |
| A: Chinese name of 2377611-94-2 is 2377611-94-2. |
| Q: What is the CAS number of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester? |
| A: CAS number of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester is 2377611-94-2. |
| Q: What is the English name of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester? |
| A: The English name of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester is 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester. |
| Q: What is the molecular formula of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester? |
| A: Molecular formula of 4-(Pyrrolidinocarbonyl)thiophene-2-boronic acid pinacol ester is C15H22BNO3S. |