(2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride
Modify Date: 2026-08-02 23:37:52
(2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride structure
|
Common Name | (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2378490-12-9 | Molecular Weight | 247.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22ClNO2 |
|---|---|
| Molecular Weight | 247.76 |
| InChIKey | DJKSQPFELZPELT-ACMTZBLWSA-N |
| SMILES | Cl.O=C(O)C1CCC(C2CCCCC2)CN1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride? |
| A: InChIKey of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride is DJKSQPFELZPELT-ACMTZBLWSA-N. |
| Q: What is the CAS number of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride? |
| A: CAS number of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride is 2378490-12-9. |
| Q: What is the English name of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride? |
| A: The English name of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride is (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride. |
| Q: What is the molecular formula of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride? |
| A: Molecular formula of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride is C12H22ClNO2. |
| Q: What is the molecular weight of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride? |
| A: Molecular weight of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride is 247.76. |
| Q: What is the Chinese name of 2378490-12-9? |
| A: Chinese name of 2378490-12-9 is 2378490-12-9. |
| Q: What is the SMILES notation of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride? |
| A: SMILES notation of (2S,5R)-5-Cyclohexylpiperidine-2-carboxylic acid;hydrochloride is Cl.O=C(O)C1CCC(C2CCCCC2)CN1. |