N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide
Modify Date: 2025-09-11 17:16:11
![N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide Structure](https://www.chemsrc.com/extcaspic/122/2380057-23-6.png)
N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide structure
|
Common Name | N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide | ||
|---|---|---|---|---|
| CAS Number | 2380057-23-6 | Molecular Weight | 343.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17NO2S2 |
|---|---|
| Molecular Weight | 343.5 |
| InChIKey | YDNIOMMXEHDZEY-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccccc1)C(=O)NCc1cc(-c2ccsc2)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide? |
| A: CAS number of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide is 2380057-23-6. |
| Q: What is the Chinese name of 2380057-23-6? |
| A: Chinese name of 2380057-23-6 is 2380057-23-6. |
| Q: What is the English name of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide? |
| A: The English name of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide is N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide. |
| Q: What is the SMILES notation of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide? |
| A: SMILES notation of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide is CC(Oc1ccccc1)C(=O)NCc1cc(-c2ccsc2)cs1. |
| Q: What is the molecular weight of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide? |
| A: Molecular weight of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide is 343.5. |
| Q: What is the InChIKey of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide? |
| A: InChIKey of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide is YDNIOMMXEHDZEY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide? |
| A: Molecular formula of N-({[3,3'-bithiophene]-5-yl}methyl)-2-phenoxypropanamide is C18H17NO2S2. |