N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline
Modify Date: 2026-07-23 11:07:23
![N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline Structure](https://www.chemsrc.com/extcaspic/049/2380063-49-8.png)
N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline structure
|
Common Name | N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline | ||
|---|---|---|---|---|
| CAS Number | 2380063-49-8 | Molecular Weight | 320.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24N2O |
|---|---|
| Molecular Weight | 320.4 |
| InChIKey | OSBNZRMBFKVUEX-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc(C(=O)N2CC3(CC(c4ccccc4)C3)C2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline? |
| A: SMILES notation of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline is CN(C)c1cccc(C(=O)N2CC3(CC(c4ccccc4)C3)C2)c1. |
| Q: What is the Chinese name of 2380063-49-8? |
| A: Chinese name of 2380063-49-8 is 2380063-49-8. |
| Q: What is the molecular formula of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline? |
| A: Molecular formula of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline is C21H24N2O. |
| Q: What is the English name of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline? |
| A: The English name of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline is N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline. |
| Q: What is the molecular weight of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline? |
| A: Molecular weight of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline is 320.4. |
| Q: What is the InChIKey of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline? |
| A: InChIKey of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline is OSBNZRMBFKVUEX-UHFFFAOYSA-N. |
| Q: What is the CAS number of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline? |
| A: CAS number of N,N-dimethyl-3-{6-phenyl-2-azaspiro[3.3]heptane-2-carbonyl}aniline is 2380063-49-8. |