1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione
Modify Date: 2026-08-01 00:32:32
1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione structure
|
Common Name | 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 2380098-43-9 | Molecular Weight | 262.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15FN2O2 |
|---|---|
| Molecular Weight | 262.28 |
| InChIKey | ZHLMQHPVDQTBNL-UHFFFAOYSA-N |
| SMILES | C=C(C)CN1CCN(c2ccccc2F)C(=O)C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione? |
| A: Molecular formula of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione is C14H15FN2O2. |
| Q: What is the CAS number of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione? |
| A: CAS number of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione is 2380098-43-9. |
| Q: What is the molecular weight of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione? |
| A: Molecular weight of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione is 262.28. |
| Q: What is the Chinese name of 2380098-43-9? |
| A: Chinese name of 2380098-43-9 is 2380098-43-9. |
| Q: What is the SMILES notation of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione? |
| A: SMILES notation of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione is C=C(C)CN1CCN(c2ccccc2F)C(=O)C1=O. |
| Q: What is the English name of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione? |
| A: The English name of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione is 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione. |
| Q: What is the InChIKey of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione? |
| A: InChIKey of 1-(2-Fluorophenyl)-4-(2-methylprop-2-enyl)piperazine-2,3-dione is ZHLMQHPVDQTBNL-UHFFFAOYSA-N. |