11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene
Modify Date: 2025-09-05 18:58:13
![11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene Structure](https://www.chemsrc.com/extcaspic/155/2380098-51-9.png)
11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene structure
|
Common Name | 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene | ||
|---|---|---|---|---|
| CAS Number | 2380098-51-9 | Molecular Weight | 257.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N5O |
|---|---|
| Molecular Weight | 257.29 |
| InChIKey | IUGBPZQKUVIEJK-UHFFFAOYSA-N |
| SMILES | COc1ccnc(N2C3CCC2c2cn[nH]c2C3)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene? |
| A: CAS number of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene is 2380098-51-9. |
| Q: What is the InChIKey of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene? |
| A: InChIKey of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene is IUGBPZQKUVIEJK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene? |
| A: Molecular weight of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene is 257.29. |
| Q: What is the molecular formula of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene? |
| A: Molecular formula of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene is C13H15N5O. |
| Q: What is the Chinese name of 2380098-51-9? |
| A: Chinese name of 2380098-51-9 is 2380098-51-9. |
| Q: What is the English name of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene? |
| A: The English name of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene is 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene. |
| Q: What is the SMILES notation of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene? |
| A: SMILES notation of 11-(4-Methoxypyrimidin-2-yl)-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene is COc1ccnc(N2C3CCC2c2cn[nH]c2C3)n1. |