3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine
Modify Date: 2026-08-03 12:10:19
![3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine Structure](https://www.chemsrc.com/extcaspic/079/2380098-97-3.png)
3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine structure
|
Common Name | 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine | ||
|---|---|---|---|---|
| CAS Number | 2380098-97-3 | Molecular Weight | 369.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20FN5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H20FN5S |
|---|---|
| Molecular Weight | 369.5 |
| InChIKey | SGSSWBOWNWCWTM-UHFFFAOYSA-N |
| SMILES | Cc1nc(CN2CCN(c3ccc(-c4cccc(F)c4)nn3)CC2)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine? |
| A: CAS number of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine is 2380098-97-3. |
| Q: What is the molecular formula of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine? |
| A: Molecular formula of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine is C19H20FN5S. |
| Q: What is the InChIKey of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine? |
| A: InChIKey of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine is SGSSWBOWNWCWTM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine? |
| A: SMILES notation of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine is Cc1nc(CN2CCN(c3ccc(-c4cccc(F)c4)nn3)CC2)cs1. |
| Q: What is the Chinese name of 2380098-97-3? |
| A: Chinese name of 2380098-97-3 is 2380098-97-3. |
| Q: What is the English name of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine? |
| A: The English name of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine is 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine. |
| Q: What is the molecular weight of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine? |
| A: Molecular weight of 3-(3-Fluorophenyl)-6-{4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl}pyridazine is 369.5. |