2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide
Modify Date: 2025-09-04 17:40:43
![2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide Structure](https://www.chemsrc.com/extcaspic/252/2380190-25-8.png)
2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide structure
|
Common Name | 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide | ||
|---|---|---|---|---|
| CAS Number | 2380190-25-8 | Molecular Weight | 392.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H15Cl2NO2S |
|---|---|
| Molecular Weight | 392.3 |
| InChIKey | MAXSMPCLHYSEIW-UHFFFAOYSA-N |
| SMILES | O=C(NCC(O)c1ccc(-c2cccs2)cc1)c1cc(Cl)ccc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide? |
| A: InChIKey of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide is MAXSMPCLHYSEIW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2380190-25-8? |
| A: Chinese name of 2380190-25-8 is 2380190-25-8. |
| Q: What is the CAS number of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide? |
| A: CAS number of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide is 2380190-25-8. |
| Q: What is the molecular formula of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide? |
| A: Molecular formula of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide is C19H15Cl2NO2S. |
| Q: What is the English name of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide? |
| A: The English name of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide is 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide. |
| Q: What is the SMILES notation of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide? |
| A: SMILES notation of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide is O=C(NCC(O)c1ccc(-c2cccs2)cc1)c1cc(Cl)ccc1Cl. |
| Q: What is the molecular weight of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide? |
| A: Molecular weight of 2,5-dichloro-N-{2-hydroxy-2-[4-(thiophen-2-yl)phenyl]ethyl}benzamide is 392.3. |