Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate
Modify Date: 2026-07-08 14:30:35
Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate structure
|
Common Name | Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2381016-69-7 | Molecular Weight | 257.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23NO4 |
|---|---|
| Molecular Weight | 257.33 |
| InChIKey | MVHJLPVFTFKCGA-UWVGGRQHSA-N |
| SMILES | COC(=O)C1CCN(C(=O)OC(C)(C)C)C(C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate? |
| A: The English name of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate is Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate. |
| Q: What is the InChIKey of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate? |
| A: InChIKey of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate is MVHJLPVFTFKCGA-UWVGGRQHSA-N. |
| Q: What is the SMILES notation of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate? |
| A: SMILES notation of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate is COC(=O)C1CCN(C(=O)OC(C)(C)C)C(C)C1. |
| Q: What is the molecular weight of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate? |
| A: Molecular weight of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate is 257.33. |
| Q: What is the molecular formula of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate? |
| A: Molecular formula of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate is C13H23NO4. |
| Q: What is the CAS number of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate? |
| A: CAS number of Cis-1-tert-butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate is 2381016-69-7. |
| Q: What is the Chinese name of 2381016-69-7? |
| A: Chinese name of 2381016-69-7 is 2381016-69-7. |