2-[2-(4-CHLOROPHENYL)-4-PHENYL-1,3-THIAZOL-5-YL]ACETIC ACID structure
|
Common Name | 2-[2-(4-CHLOROPHENYL)-4-PHENYL-1,3-THIAZOL-5-YL]ACETIC ACID | ||
|---|---|---|---|---|
| CAS Number | 23821-72-9 | Molecular Weight | 329.80100 | |
| Density | 1.362g/cm3 | Boiling Point | 554.3ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNO2S | Melting Point | 163-165ºC | |
| MSDS | N/A | Flash Point | 289ºC | |
| Name | 2-[2-(4-Chlorophenyl)-4-phenyl-1,3-thiazol-5-yl]-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 554.3ºC at 760 mmHg |
| Melting Point | 163-165ºC |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.80100 |
| Flash Point | 289ºC |
| Exact Mass | 329.02800 |
| PSA | 78.43000 |
| LogP | 4.75760 |
| Vapour Pressure | 4.02E-13mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | IGIVWRJICPRDTF-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1sc(-c2ccc(Cl)cc2)nc1-c1ccccc1 |
| HS Code | 2934100090 |
|---|
|
~%
2-[2-(4-CHLOROP... CAS#:23821-72-9 |
| Literature: Rist, ystein; Grimstrup, Marie; Receveur, Jean-Marie; Frimurer, Thomas M.; Ulven, Trond; Kostenis, Evi; Hoegberg, Thomas Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 3 p. 1177 - 1180 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-[2-(4-chlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid |