N-[2-(Diethylamino)ethyl]-N-[2-(dimethylamino)ethyl]-2-pyridinamine structure
|
Common Name | N-[2-(Diethylamino)ethyl]-N-[2-(dimethylamino)ethyl]-2-pyridinamine | ||
|---|---|---|---|---|
| CAS Number | 23826-82-6 | Molecular Weight | 264.41000 | |
| Density | 0.989g/cm3 | Boiling Point | 362.2ºC at 760 mmHg | |
| Molecular Formula | C15H28N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.9ºC | |
| Name | N'-[2-(diethylamino)ethyl]-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.989g/cm3 |
|---|---|
| Boiling Point | 362.2ºC at 760 mmHg |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.41000 |
| Flash Point | 172.9ºC |
| Exact Mass | 264.23100 |
| PSA | 22.61000 |
| LogP | 1.79140 |
| Vapour Pressure | 1.96E-05mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | GIBQIAXYYREBFD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN(CCN(C)C)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine,2-(N-(2-diethylaminoethyl)-N-(2-dimethylaminoethyl)amino) |
| R.605 |
| (2-diethylamino-ethyl)-(2-dimethylamino-ethyl)-pyridin-2-yl-amine |
| 2-(N-(2-Diethylaminoethyl)-N-(2-dimethylaminoethyl)amino)pyridine |
| n-[2-(diethylamino)ethyl]-n',n'-dimethyl-n-(pyridin-2-yl)ethane-1,2-diamine |