4-Chloro-8-nitroquinoline structure
|
Common Name | 4-Chloro-8-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 23833-99-0 | Molecular Weight | 208.601 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 339.9±27.0 °C at 760 mmHg | |
| Molecular Formula | C9H5ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.4±23.7 °C | |
| Name | 4-chloro-8-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.9±27.0 °C at 760 mmHg |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.601 |
| Flash Point | 159.4±23.7 °C |
| Exact Mass | 208.003952 |
| PSA | 58.71000 |
| LogP | 2.16 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | AOATVJLAFLBGPZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2c(Cl)ccnc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-8-nitroquinoline |
| 4-Chloro-8-nitro-quinoline |
| Quinoline, 4-chloro-8-nitro- |
| 4-Chlor-8-nitrochinolin |
| Quinoline,4-chloro-8-nitro |
| 8-Nitro-4-chlorchinolin |
| 8-nitro-4-chloroquinoline |