enoxastrobin structure
|
Common Name | enoxastrobin | ||
|---|---|---|---|---|
| CAS Number | 238410-11-2 | Molecular Weight | 399.87 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of enoxastrobinEnoxastrobin (Enestroburin) is an anti-fungal agent. Enoxastrobin is active against P. oryzae and B. cinerea[1]. |
| Name | enoxastrobin |
|---|---|
| Synonym | More Synonyms |
| Description | Enoxastrobin (Enestroburin) is an anti-fungal agent. Enoxastrobin is active against P. oryzae and B. cinerea[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Enoxastrobin 对 P. oryzaeL (8.3 μg/mL) 和 B. cinerea (6.25 μg/mL) 有活性。 |
| References |
| Molecular Formula | C22H22ClNO4 |
|---|---|
| Molecular Weight | 399.87 |
| Exact Mass | 399.12400 |
| PSA | 57.12000 |
| LogP | 5.10620 |
| InChIKey | VMNULHCTRPXWFJ-UJSVPXBISA-N |
| SMILES | COC=C(C(=O)OC)c1ccccc1CON=C(C)C=Cc1ccc(Cl)cc1 |
| methyl (αE)-2-[[[(E)-[(2E)-3-(4-chlorophenyl)-1-methyl-2-propen-1-ylidene]amino]oxy]methyl]-α-(methoxymethylene)benzeneaceate |
| xiwojunzhi |
| methyl (Z)-2-[2-[[(E)-[(E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| methyl (2E)-2-{2-[({(E)-[(2E)-3-(4-chlorophenyl)-1-methylprop-2-enylidene]amino}oxy)methyl]phenyl}-3-methoxyacrylate |
| Xiwojunzhi |
| SYP Z071 |
| enestroburin |
| methyl (2E)-2-{2-[({[(2E,3E)-4-(4-chlorophenyl)but-3-en-2-ylidene]amino}oxy)methyl]phenyl}-3-methoxyprop-2-enoate |
| Enoxastrobin |