dichlorprop-methyl structure
|
Common Name | dichlorprop-methyl | ||
|---|---|---|---|---|
| CAS Number | 23844-57-7 | Molecular Weight | 249.091 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 307.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.3±22.7 °C | |
| Name | methyl (±)-2-(2,4-dichlorophenoxy)propionate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.2±27.0 °C at 760 mmHg |
| Molecular Formula | C10H10Cl2O3 |
| Molecular Weight | 249.091 |
| Flash Point | 123.3±22.7 °C |
| Exact Mass | 248.000702 |
| PSA | 35.53000 |
| LogP | 3.00 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | SCHCPDWDIOTCMJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
dichlorprop-methyl CAS#:23844-57-7 |
| Literature: Chenevert, Robert; D'Astous, Linda Canadian Journal of Chemistry, 1988 , vol. 66, p. 1219 - 1222 |
|
~%
dichlorprop-methyl CAS#:23844-57-7 |
| Literature: Dernoncour; Azerad Tetrahedron Letters, 1987 , vol. 28, # 40 p. 4661 - 4664 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-Dichlorphenylglyoxylonitril |
| 2,4-Dichlorophenylglyoxylonitrile |
| 2,4-dichlorprop methyl |
| dichlorprop-methyl |
| 2,4-Dichloro-|A-oxo-benzeneacetonitrile |
| Propanoic acid, 2-(2,4-dichlorophenoxy)-, methyl ester |
| 2-(2,4-dichlorophenoxy)propanoic acid methyl ester |
| GR CG DOY1&VO1 |
| Methyl 2-(2,4-dichlorophenoxy)propanoate |
| methyl 2-(2',4'-dichlorophenoxy)-propionate |