1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate
Modify Date: 2026-09-27 16:38:58
1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate structure
|
Common Name | 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2384650-26-2 | Molecular Weight | 311.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18FNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18FNO6S |
|---|---|
| Molecular Weight | 311.33 |
| InChIKey | VYHMJJDVFDVBMK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C(=O)OC(C)(C)C)CC1S(=O)(=O)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate? |
| A: Molecular weight of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate is 311.33. |
| Q: What is the Chinese name of 2384650-26-2? |
| A: Chinese name of 2384650-26-2 is 2384650-26-2. |
| Q: What is the SMILES notation of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate? |
| A: SMILES notation of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate is COC(=O)C1CN(C(=O)OC(C)(C)C)CC1S(=O)(=O)F. |
| Q: What is the molecular formula of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate? |
| A: Molecular formula of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate is C11H18FNO6S. |
| Q: What is the English name of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate? |
| A: The English name of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate is 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate. |
| Q: What is the InChIKey of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate? |
| A: InChIKey of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate is VYHMJJDVFDVBMK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate? |
| A: CAS number of 1-Tert-butyl 3-methyl 4-(fluorosulfonyl)pyrrolidine-1,3-dicarboxylate is 2384650-26-2. |