Benzyl 2-(benzyloxy)-3-bromobenzoate
Modify Date: 2025-09-01 09:17:07
Benzyl 2-(benzyloxy)-3-bromobenzoate structure
|
Common Name | Benzyl 2-(benzyloxy)-3-bromobenzoate | ||
|---|---|---|---|---|
| CAS Number | 2385018-47-1 | Molecular Weight | 397.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 2-(benzyloxy)-3-bromobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H17BrO3 |
|---|---|
| Molecular Weight | 397.3 |
| InChIKey | CNSAUGAXQGXOED-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)c1cccc(Br)c1OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzyl 2-(benzyloxy)-3-bromobenzoate? |
| A: InChIKey of Benzyl 2-(benzyloxy)-3-bromobenzoate is CNSAUGAXQGXOED-UHFFFAOYSA-N. |
| Q: What is the English name of Benzyl 2-(benzyloxy)-3-bromobenzoate? |
| A: The English name of Benzyl 2-(benzyloxy)-3-bromobenzoate is Benzyl 2-(benzyloxy)-3-bromobenzoate. |
| Q: What is the Chinese name of 2385018-47-1? |
| A: Chinese name of 2385018-47-1 is 2385018-47-1. |
| Q: What is the molecular weight of Benzyl 2-(benzyloxy)-3-bromobenzoate? |
| A: Molecular weight of Benzyl 2-(benzyloxy)-3-bromobenzoate is 397.3. |
| Q: What is the molecular formula of Benzyl 2-(benzyloxy)-3-bromobenzoate? |
| A: Molecular formula of Benzyl 2-(benzyloxy)-3-bromobenzoate is C21H17BrO3. |
| Q: What is the SMILES notation of Benzyl 2-(benzyloxy)-3-bromobenzoate? |
| A: SMILES notation of Benzyl 2-(benzyloxy)-3-bromobenzoate is O=C(OCc1ccccc1)c1cccc(Br)c1OCc1ccccc1. |
| Q: What is the CAS number of Benzyl 2-(benzyloxy)-3-bromobenzoate? |
| A: CAS number of Benzyl 2-(benzyloxy)-3-bromobenzoate is 2385018-47-1. |