1-(p-Chlorobenzoyl)-1H-indazol-5-amine structure
|
Common Name | 1-(p-Chlorobenzoyl)-1H-indazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 23856-19-1 | Molecular Weight | 271.70200 | |
| Density | 1.41g/cm3 | Boiling Point | 518ºC at 760mmHg | |
| Molecular Formula | C14H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.1ºC | |
| Name | (5-aminoindazol-1-yl)-(4-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 518ºC at 760mmHg |
| Molecular Formula | C14H10ClN3O |
| Molecular Weight | 271.70200 |
| Flash Point | 267.1ºC |
| Exact Mass | 271.05100 |
| PSA | 60.91000 |
| LogP | 3.54160 |
| Vapour Pressure | 7.79E-11mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | WXPPAZGAWMWWCE-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(cnn2C(=O)c2ccc(Cl)cc2)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazol-5-amine,1-(p-chlorobenzoyl) |
| 1-(p-Chlorbenzoyl)-5-amino-1H-indazol |
| 1-(p-Chlorobenzoyl)-1H-indazol-5-amine |
| 1-(4-chloro-benzoyl)-1H-indazol-5-ylamine |
| (5-amino-1h-indazol-1-yl)(4-chlorophenyl)methanone |