4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid
Modify Date: 2025-09-10 19:43:33
![4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid Structure](https://www.chemsrc.com/extcaspic/139/2386302-80-1.png)
4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid structure
|
Common Name | 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2386302-80-1 | Molecular Weight | 444.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H20N2O6 |
|---|---|
| Molecular Weight | 444.4 |
| InChIKey | IHFMVDORZFNHOD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N(C(=O)OCC2c3ccccc3-c3ccccc32)C2CC2)c([N+](=O)[O-])c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid? |
| A: Molecular formula of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid is C25H20N2O6. |
| Q: What is the CAS number of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid? |
| A: CAS number of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid is 2386302-80-1. |
| Q: What is the English name of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid? |
| A: The English name of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid is 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid. |
| Q: What is the SMILES notation of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid? |
| A: SMILES notation of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid is O=C(O)c1ccc(N(C(=O)OCC2c3ccccc3-c3ccccc32)C2CC2)c([N+](=O)[O-])c1. |
| Q: What is the Chinese name of 2386302-80-1? |
| A: Chinese name of 2386302-80-1 is 2386302-80-1. |
| Q: What is the InChIKey of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid? |
| A: InChIKey of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid is IHFMVDORZFNHOD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid? |
| A: Molecular weight of 4-[cyclopropyl({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]-3-nitrobenzoic acid is 444.4. |