Benzoic acid, 2-[(4-Methoxyphenyl)amino]-, ethyl ester structure
|
Common Name | Benzoic acid, 2-[(4-Methoxyphenyl)amino]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 23868-19-1 | Molecular Weight | 271.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(4-methoxyanilino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NO3 |
|---|---|
| Molecular Weight | 271.31100 |
| Exact Mass | 271.12100 |
| PSA | 47.56000 |
| LogP | 3.68850 |
| InChIKey | PGEAAYPGBFRMCG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1Nc1ccc(OC)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(4-methoxy-anilino)-benzoic acid ethyl ester |
| 2-(p-Methoxy-phenylamino)-benzoesaeure-ethylester |
| ethyl 2-(4-methoxyphenylamino)benzoate |
| Benzoic acid,2-[(4-methoxyphenyl)amino]-,ethyl ester |