dibutylammonium dibutyldithiocarbamate structure
|
Common Name | dibutylammonium dibutyldithiocarbamate | ||
|---|---|---|---|---|
| CAS Number | 2391-80-2 | Molecular Weight | 334.62700 | |
| Density | N/A | Boiling Point | 257.7ºC at 760mmHg | |
| Molecular Formula | C17H38N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.6ºC | |
| Name | N-butylbutan-1-amine,dibutylcarbamodithioic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 257.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C17H38N2S2 |
| Molecular Weight | 334.62700 |
| Flash Point | 109.6ºC |
| Exact Mass | 334.24800 |
| PSA | 86.16000 |
| LogP | 5.67040 |
| Vapour Pressure | 0.0144mmHg at 25°C |
| InChIKey | YPQOCKOIFRNBQW-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C(=S)S.CCCCNCCCC |
| HS Code | 2930909090 |
|---|
|
~%
dibutylammonium... CAS#:2391-80-2 |
| Literature: Maier,L. Angewandte Chemie, 1969 , vol. 81, p. 154 |
|
~81%
dibutylammonium... CAS#:2391-80-2 |
| Literature: Souza, Antonio G. de; Souza, Jose H. de; Airoldi, Claudio Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1991 , # 7 p. 1751 - 1754 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-butylbutan-1-amine |
| EINECS 219-242-5 |
| di-n-butylammonium di-n-butyldithiocabamate |
| N,N-Dibutylammonium-N,N-dibutyl-dithiocarbamat |
| dibutylcarbamodithioic acid-N-butylbutan-1-amine (1:1) |
| Dibutylammonium dibutyldithiocarbamate |
| Carbamodithioic acid,dibutyl-,compd. with N-butyl-1-butanamine (1:1) |
| Di-n-butylammonium di-n-butyldithiocarbamate |
| (dibutylamino)methanedithioic acid |