[4-[4-(4-benzoyl-3-hydroxyphenoxy)butoxy]-2-hydroxyphenyl]-phenylmethanone structure
|
Common Name | [4-[4-(4-benzoyl-3-hydroxyphenoxy)butoxy]-2-hydroxyphenyl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 23911-80-0 | Molecular Weight | 482.52400 | |
| Density | 1.255g/cm3 | Boiling Point | 680.224ºC at 760 mmHg | |
| Molecular Formula | C30H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.19ºC | |
| Name | [4-[4-(4-benzoyl-3-hydroxyphenoxy)butoxy]-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 680.224ºC at 760 mmHg |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.52400 |
| Flash Point | 225.19ºC |
| Exact Mass | 482.17300 |
| PSA | 93.06000 |
| LogP | 5.79780 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | XTXAZHSPVHPNSL-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(OCCCCOc2ccc(C(=O)c3ccccc3)c(O)c2)cc1O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-BIS(4-BENZOYL-3-HYDROXYPHENOXY)-BUTANE |
| 1,4-Di-(3'-hydroxy-4'-benzoylphenoxy)-butan |