2-(3-chloro-4-propan-2-yloxyphenyl)acetic acid structure
|
Common Name | 2-(3-chloro-4-propan-2-yloxyphenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 23914-90-1 | Molecular Weight | 228.67200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-chloro-4-propan-2-yloxyphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13ClO3 |
|---|---|
| Molecular Weight | 228.67200 |
| Exact Mass | 228.05500 |
| PSA | 46.53000 |
| LogP | 2.75430 |
| InChIKey | IDIYIZMETAUIPJ-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(CC(=O)O)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
2-(3-chloro-4-p... CAS#:23914-90-1 |
| Literature: Kuchar; Brunova; Roubal; et al. Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 5 p. 1401 - 1407 |
|
~%
2-(3-chloro-4-p... CAS#:23914-90-1 |
| Literature: Kuchar; Brunova; Roubal; et al. Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 5 p. 1401 - 1407 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Isopropoxy-3-chlorophenylacetic acid |
| Benzeneacetic acid,3-chloro-4-(1-methylethoxy) |