4-[Di(2-hydroxyethyl)amino]-1-[(2-methoxyethyl)amino]-2-nitrobenzene structure
|
Common Name | 4-[Di(2-hydroxyethyl)amino]-1-[(2-methoxyethyl)amino]-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 23920-15-2 | Molecular Weight | 299.32300 | |
| Density | 1.323 | Boiling Point | 538.371ºC at 760 mmHg | |
| Molecular Formula | C13H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.397ºC | |
| Name | 2-[N-(2-hydroxyethyl)-4-(2-methoxyethylamino)-3-nitroanilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323 |
|---|---|
| Boiling Point | 538.371ºC at 760 mmHg |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.32300 |
| Flash Point | 279.397ºC |
| Exact Mass | 299.14800 |
| PSA | 110.78000 |
| LogP | 1.04030 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | YCAQIPZHGGRGEI-UHFFFAOYSA-N |
| SMILES | COCCNc1ccc(N(CCO)CCO)cc1[N+](=O)[O-] |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-[(2'-Methoxyethyl)amino]-2-nitro-4-[di-(2'-hydroxyethyl)amino]benzene |
| 2-[2-hydroxyethyl-[4-(2-methoxyethylamino)-3-nitro-phenyl]amino]ethanol |
| 2,2'-[[4-[(2-Methoxyethyl)amino]-3-nitrophenyl]imino]bis-ethanol |
| 1-(2'-methoxyethyl)amino-2-nitro-4-bis(2'-hydroxyethyl)aminobenzene |
| I01-9808 |
| HC blue No. 11 |
| 4-[di(2-hydroxyethyl)amino]-1-[(2-methoxyethyl)amino]-2-nitrobenzene |