N'-[α-(p-Chlorophenyl)benzyl]-N,N-diethylethylenediamine structure
|
Common Name | N'-[α-(p-Chlorophenyl)benzyl]-N,N-diethylethylenediamine | ||
|---|---|---|---|---|
| CAS Number | 23921-02-0 | Molecular Weight | 316.86800 | |
| Density | 1.068g/cm3 | Boiling Point | 414ºC at 760mmHg | |
| Molecular Formula | C19H25ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.2ºC | |
| Name | N-[(4-chlorophenyl)-phenylmethyl]-N',N'-diethylethane-1,2-diamine |
|---|
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 414ºC at 760mmHg |
| Molecular Formula | C19H25ClN2 |
| Molecular Weight | 316.86800 |
| Flash Point | 204.2ºC |
| Exact Mass | 316.17100 |
| PSA | 15.27000 |
| LogP | 4.75170 |
| Vapour Pressure | 4.58E-07mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | OHPDZWXSAPXYSM-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(c1ccccc1)c1ccc(Cl)cc1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |