1-bromo-4-[(4-bromophenyl)sulfonylmethylsulfonyl]benzene structure
|
Common Name | 1-bromo-4-[(4-bromophenyl)sulfonylmethylsulfonyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 2394-04-9 | Molecular Weight | 454.15400 | |
| Density | 1.818g/cm3 | Boiling Point | 614.8ºC at 760 mmHg | |
| Molecular Formula | C13H10Br2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.6ºC | |
| Name | 1-bromo-4-[(4-bromophenyl)sulfonylmethylsulfonyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.818g/cm3 |
|---|---|
| Boiling Point | 614.8ºC at 760 mmHg |
| Molecular Formula | C13H10Br2O4S2 |
| Molecular Weight | 454.15400 |
| Flash Point | 325.6ºC |
| Exact Mass | 451.83900 |
| PSA | 85.04000 |
| LogP | 5.57830 |
| Vapour Pressure | 2.18E-14mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | GNLWRDUYIDEDLG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(CS(=O)(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Bis-<4-brom-phenylsulfonyl>-methan |