9,10-Anthracenedione,1,4-dihydroxy-5,8-bis[(4-methylphenyl)amino]- structure
|
Common Name | 9,10-Anthracenedione,1,4-dihydroxy-5,8-bis[(4-methylphenyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 23941-48-2 | Molecular Weight | 450.48500 | |
| Density | 1.405g/cm3 | Boiling Point | 692.5ºC at 760mmHg | |
| Molecular Formula | C28H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.6ºC | |
| Name | 1,4-dihydroxy-5,8-bis(4-methylanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 692.5ºC at 760mmHg |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.48500 |
| Flash Point | 372.6ºC |
| Exact Mass | 450.15800 |
| PSA | 98.66000 |
| LogP | 6.12320 |
| Vapour Pressure | 8.09E-20mmHg at 25°C |
| Index of Refraction | 1.751 |
| InChIKey | OZQQAZPMNWJRDQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2ccc(Nc3ccc(C)cc3)c3c2C(=O)c2c(O)ccc(O)c2C3=O)cc1 |
| HS Code | 2922509090 |
|---|
|
~%
9,10-Anthracene... CAS#:23941-48-2 |
| Literature: I. G. Farbenind. Patent: DE445846 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 15, p. 677 |
|
~%
9,10-Anthracene... CAS#:23941-48-2 |
| Literature: Hoechster Farbw. Patent: DE205149 ; |
|
~%
9,10-Anthracene... CAS#:23941-48-2 |
| Literature: Weller; Porai-Koschiz Zhurnal Prikladnoi Khimii (Sankt-Peterburg, Russian Federation), 1955 , vol. 28, p. 497,500; engl. Ausg. S. 473, 476 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5.8-Di-p-toluidino-1.4-dihydroy-anthrachinon |
| 5,8-Di-x-toluidinoquinizarin |
| 5,4-dihydroxyanthraquinone |
| 1,4-dihydroxy-5,8-di-p-toluidino-anthraquinone |
| 1,4-Dihydroxy-5,8-di-p-toluidino-anthrachinon |
| 5.8-Di-p-toluidino-chinizarin |