1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione
Modify Date: 2025-11-06 08:04:50
1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione structure
|
Common Name | 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 23947-33-3 | Molecular Weight | 220.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12N2O3 |
|---|---|
| Molecular Weight | 220.22 |
| InChIKey | PCUUMCBQIMQBTC-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1CCC(=O)NC1=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Binding affinity to recombinant human CRBN/DDB1 incubated for 20 mins by fluorescence...
Source: ChEMBL
Target: Protein cereblon
External Id: CHEMBL5382228
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione? |
| A: The English name of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione is 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione. |
| Q: What is the SMILES notation of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione? |
| A: SMILES notation of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione is COc1ccccc1N1CCC(=O)NC1=O. |
| Q: What is the Chinese name of 23947-33-3? |
| A: Chinese name of 23947-33-3 is 23947-33-3. |
| Q: What is the InChIKey of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione? |
| A: InChIKey of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione is PCUUMCBQIMQBTC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione? |
| A: CAS number of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione is 23947-33-3. |
| Q: What is the molecular weight of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione? |
| A: Molecular weight of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione is 220.22. |
| Q: What is the molecular formula of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione? |
| A: Molecular formula of 1-(2-Methoxyphenyl)hexahydropyrimidine-2,4-dione is C11H12N2O3. |