[1,1a(2)-Biphenyl]-3-acetamide
Modify Date: 2026-09-27 01:11:31
![[1,1a(2)-Biphenyl]-3-acetamide Structure](https://www.chemsrc.com/extcaspic/062/23948-78-9.png)
[1,1a(2)-Biphenyl]-3-acetamide structure
|
Common Name | [1,1a(2)-Biphenyl]-3-acetamide | ||
|---|---|---|---|---|
| CAS Number | 23948-78-9 | Molecular Weight | 211.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1,1a(2)-Biphenyl]-3-acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13NO |
|---|---|
| Molecular Weight | 211.26 |
| InChIKey | KIMNOZCKYZPQSU-UHFFFAOYSA-N |
| SMILES | NC(=O)Cc1cccc(-c2ccccc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [1,1a(2)-Biphenyl]-3-acetamide? |
| A: InChIKey of [1,1a(2)-Biphenyl]-3-acetamide is KIMNOZCKYZPQSU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [1,1a(2)-Biphenyl]-3-acetamide? |
| A: Molecular weight of [1,1a(2)-Biphenyl]-3-acetamide is 211.26. |
| Q: What is the Chinese name of 23948-78-9? |
| A: Chinese name of 23948-78-9 is 23948-78-9. |
| Q: What is the molecular formula of [1,1a(2)-Biphenyl]-3-acetamide? |
| A: Molecular formula of [1,1a(2)-Biphenyl]-3-acetamide is C14H13NO. |
| Q: What is the SMILES notation of [1,1a(2)-Biphenyl]-3-acetamide? |
| A: SMILES notation of [1,1a(2)-Biphenyl]-3-acetamide is NC(=O)Cc1cccc(-c2ccccc2)c1. |
| Q: What is the CAS number of [1,1a(2)-Biphenyl]-3-acetamide? |
| A: CAS number of [1,1a(2)-Biphenyl]-3-acetamide is 23948-78-9. |
| Q: What is the English name of [1,1a(2)-Biphenyl]-3-acetamide? |
| A: The English name of [1,1a(2)-Biphenyl]-3-acetamide is [1,1a(2)-Biphenyl]-3-acetamide. |