3,5-dichloro-4-ethoxy-N-[(E)-1-phenylpropan-2-ylideneamino]benzamide
Modify Date: 2025-08-25 16:04:20
![3,5-dichloro-4-ethoxy-N-[(E)-1-phenylpropan-2-ylideneamino]benzamide Structure](https://image.chemsrc.com/caspic/374/23959-61-7.png)
3,5-dichloro-4-ethoxy-N-[(E)-1-phenylpropan-2-ylideneamino]benzamide structure
|
Common Name | 3,5-dichloro-4-ethoxy-N-[(E)-1-phenylpropan-2-ylideneamino]benzamide | ||
|---|---|---|---|---|
| CAS Number | 23959-61-7 | Molecular Weight | 365.25400 | |
| Density | 1.23g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H18Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dichloro-4-ethoxy-N-[(E)-1-phenylpropan-2-ylideneamino]benzamide |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.25400 |
| Exact Mass | 364.07500 |
| PSA | 54.18000 |
| LogP | 5.31530 |
| Index of Refraction | 1.575 |
| InChIKey | DPYMTXSTLSODSW-CIAFOILYSA-N |
| SMILES | CCOc1c(Cl)cc(C(=O)NN=C(C)Cc2ccccc2)cc1Cl |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |