(+/-)-LAVANDULYL SENECIOATE structure
|
Common Name | (+/-)-LAVANDULYL SENECIOATE | ||
|---|---|---|---|---|
| CAS Number | 23960-07-8 | Molecular Weight | 236.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl] 3-methylbut-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24O2 |
|---|---|
| Molecular Weight | 236.35000 |
| Exact Mass | 236.17800 |
| PSA | 26.30000 |
| LogP | 4.04440 |
| InChIKey | STLUIDJQVVNOAV-UHFFFAOYSA-N |
| SMILES | C=C(C)C(CC=C(C)C)COC(=O)C=C(C)C |
| HS Code | 2916190090 |
|---|
|
~%
(+/-)-LAVANDULY... CAS#:23960-07-8 |
| Literature: Kuraray Co., Ltd. Patent: EP2119693 A1, 2009 ; Location in patent: Page/Page column 5 ; |
|
~83%
(+/-)-LAVANDULY... CAS#:23960-07-8 |
| Literature: KURARAY CO., LTD. Patent: WO2006/109570 A1, 2006 ; Location in patent: Page/Page column 9-10 ; |
|
~90%
(+/-)-LAVANDULY... CAS#:23960-07-8 |
| Literature: KURARAY CO., LTD. Patent: WO2006/109570 A1, 2006 ; Location in patent: Page/Page column 8-9 ; |
|
~87%
(+/-)-LAVANDULY... CAS#:23960-07-8 |
| Literature: KURARAY CO., LTD. Patent: WO2006/109570 A1, 2006 ; Location in patent: Page/Page column 8 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2-isopropenyl-5-methyl-4-hexen-1-yl 3-methyl-2-butenoate |
| 2-isopropenyl-5-methyl-4-hexene-1-yl 3-methyl-2-butenoate |
| (S)-( )-lavandulyl senecioate |
| Lavandulyl Senecioate |