Benzoic acid 4-hydroxyiminocyclohexyl ester
Modify Date: 2025-09-23 10:19:35
Benzoic acid 4-hydroxyiminocyclohexyl ester structure
|
Common Name | Benzoic acid 4-hydroxyiminocyclohexyl ester | ||
|---|---|---|---|---|
| CAS Number | 23968-54-9 | Molecular Weight | 233.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-hydroxyiminocyclohexyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15NO3 |
|---|---|
| Molecular Weight | 233.26300 |
| Exact Mass | 233.10500 |
| PSA | 58.89000 |
| LogP | 2.61620 |
| InChIKey | KOWWXOPRRFVSPZ-UHFFFAOYSA-N |
| SMILES | O=C(OC1CCC(=NO)CC1)c1ccccc1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:82386-70-7| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Cyclohexanone,4-(benzoyloxy)-,oxime |
| Benzoic acid 4-hydroxyiminocyclohexyl ester |
| 4-(Hydroxyimino)cyclohexyl benzoate |