N-(chloro(phenyl)Methylene)-N-Methylmethanaminium chloride structure
|
Common Name | N-(chloro(phenyl)Methylene)-N-Methylmethanaminium chloride | ||
|---|---|---|---|---|
| CAS Number | 2397-26-4 | Molecular Weight | 204.09600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [chloro(phenyl)methylidene]-dimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11Cl2N |
|---|---|
| Molecular Weight | 204.09600 |
| Exact Mass | 203.02700 |
| PSA | 3.24000 |
| InChIKey | GGIRGRHHZRLDGX-UHFFFAOYSA-M |
| SMILES | C[N+](C)=C(Cl)c1ccccc1.[Cl-] |
|
~%
N-(chloro(pheny... CAS#:2397-26-4 |
| Literature: Baraniak, Janina; Stec, Wojcieh J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 1645 - 1656 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| N,N-dimethyl(chlorophenylmethylene)ammonium chloride |
| Benzoesaeuredimethylamid-dichlorid |
| Methanaminium,N-(chlorophenylmethylene)-N-methyl-,chloride |
| (chloro-phenyl-methylene)-dimethyl-ammonium,chloride |